C11H18N4O — CID 81087572
4-amino-N,N-bis(2-cyanoethyl)-3-methylbutanamide (PubChem CID 81087572) has the molecular formula C11H18N4O and a molecular weight of 222.29 g/mol. Its IUPAC name is 4-amino-N,N-bis(2-cyanoethyl)-3-methylbutanamide.
| Compound Name | 4-amino-N,N-bis(2-cyanoethyl)-3-methylbutanamide |
|---|---|
| PubChem CID | 81087572 |
| Molecular Formula | C11H18N4O |
| Molecular Weight | 222.29 g/mol |
| Exact Mass | 222.15 |
| IUPAC Name | 4-amino-N,N-bis(2-cyanoethyl)-3-methylbutanamide |
| SMILES | CC(CN)CC(=O)N(CCC#N)CCC#N |
| InChI | InChI=1S/C11H18N4O/c1-10(9-14)8-11(16)15(6-2-4-12)7-3-5-13/h10H,2-3,6-9,14H2,1H3 |
| InChIKey | LWGABFSLJZVCKB-UHFFFAOYSA-N |
| XLogP | 0.63 |
| TPSA | 93.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 222.29 |
| LogP ≤ 5 | 0.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |