C9H14N4O — CID 60953472
3-amino-N,N-bis(2-cyanoethyl)propanamide (PubChem CID 60953472) has the molecular formula C9H14N4O and a molecular weight of 194.24 g/mol. Its IUPAC name is 3-amino-N,N-bis(2-cyanoethyl)propanamide.
| Compound Name | 3-amino-N,N-bis(2-cyanoethyl)propanamide |
|---|---|
| PubChem CID | 60953472 |
| Molecular Formula | C9H14N4O |
| Molecular Weight | 194.24 g/mol |
| Exact Mass | 194.12 |
| IUPAC Name | 3-amino-N,N-bis(2-cyanoethyl)propanamide |
| SMILES | N#CCCN(CCC#N)C(=O)CCN |
| InChI | InChI=1S/C9H14N4O/c10-4-1-7-13(8-2-5-11)9(14)3-6-12/h1-3,6-8,12H2 |
| InChIKey | SZDSJAQAGXVREY-UHFFFAOYSA-N |
| XLogP | -0.01 |
| TPSA | 93.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 194.24 |
| LogP ≤ 5 | -0.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |