C15H18N4O2 — CID 61116679
3-(2-aminophenoxy)-N,N-bis(2-cyanoethyl)propanamide (PubChem CID 61116679) has the molecular formula C15H18N4O2 and a molecular weight of 286.33 g/mol. Its IUPAC name is 3-(2-aminophenoxy)-N,N-bis(2-cyanoethyl)propanamide.
| Compound Name | 3-(2-aminophenoxy)-N,N-bis(2-cyanoethyl)propanamide |
|---|---|
| PubChem CID | 61116679 |
| Molecular Formula | C15H18N4O2 |
| Molecular Weight | 286.33 g/mol |
| Exact Mass | 286.14 |
| IUPAC Name | 3-(2-aminophenoxy)-N,N-bis(2-cyanoethyl)propanamide |
| SMILES | N#CCCN(CCC#N)C(=O)CCOc1ccccc1N |
| InChI | InChI=1S/C15H18N4O2/c16-8-3-10-19(11-4-9-17)15(20)7-12-21-14-6-2-1-5-13(14)18/h1-2,5-6H,3-4,7,10-12,18H2 |
| InChIKey | MUSVJKJLIHFTHI-UHFFFAOYSA-N |
| XLogP | 1.69 |
| TPSA | 103.14 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 286.33 |
| LogP ≤ 5 | 1.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|