C13H18N4O2 — CID 63570448
2-[2-[2-cyanoethyl(methyl)amino]ethoxy]benzohydrazide (PubChem CID 63570448) has the molecular formula C13H18N4O2 and a molecular weight of 262.31 g/mol. Its IUPAC name is 2-[2-[2-cyanoethyl(methyl)amino]ethoxy]benzohydrazide.
| Compound Name | 2-[2-[2-cyanoethyl(methyl)amino]ethoxy]benzohydrazide |
|---|---|
| PubChem CID | 63570448 |
| Molecular Formula | C13H18N4O2 |
| Molecular Weight | 262.31 g/mol |
| Exact Mass | 262.14 |
| IUPAC Name | 2-[2-[2-cyanoethyl(methyl)amino]ethoxy]benzohydrazide |
| SMILES | CN(CCC#N)CCOc1ccccc1C(=O)NN |
| InChI | InChI=1S/C13H18N4O2/c1-17(8-4-7-14)9-10-19-12-6-3-2-5-11(12)13(18)16-15/h2-3,5-6H,4,8-10,15H2,1H3,(H,16,18) |
| InChIKey | MBRPCDGTLARTEO-UHFFFAOYSA-N |
| XLogP | 0.51 |
| TPSA | 91.38 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 262.31 |
| LogP ≤ 5 | 0.51 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'acyl_hydrazine', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|