About azane;2-(dimethylamino)acetic acid
azane;2-(dimethylamino)acetic acid (PubChem CID 172828475) has the molecular formula C4H12N2O2
and a molecular weight of 120.15 g/mol. Its IUPAC name is azane;2-(dimethylamino)acetic acid.
Molecular Properties
| Compound Name | azane;2-(dimethylamino)acetic acid |
| PubChem CID | 172828475 |
| Molecular Formula | C4H12N2O2 |
| Molecular Weight | 120.15 g/mol |
| Exact Mass | 120.09 |
| IUPAC Name | azane;2-(dimethylamino)acetic acid |
| SMILES | CN(C)CC(=O)O.N |
| InChI | InChI=1S/C4H9NO2.H3N/c1-5(2)3-4(6)7;/h3H2,1-2H3,(H,6,7);1H3 |
| InChIKey | IZJAKMBVWSOQGV-UHFFFAOYSA-N |
| XLogP | -0.21 |
| TPSA | 75.54 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 8 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 120.15 |
| LogP ≤ 5 | -0.21 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze azane;2-(dimethylamino)acetic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of azane;2-(dimethylamino)acetic acid?
The IUPAC name of azane;2-(dimethylamino)acetic acid (CID 172828475) is azane;2-(dimethylamino)acetic acid.
What is the SMILES notation for azane;2-(dimethylamino)acetic acid?
The canonical SMILES for azane;2-(dimethylamino)acetic acid is CN(C)CC(=O)O.N.
What is the InChIKey of azane;2-(dimethylamino)acetic acid?
The InChIKey is IZJAKMBVWSOQGV-UHFFFAOYSA-N. The full InChI is InChI=1S/C4H9NO2.H3N/c1-5(2)3-4(6)7;/h3H2,1-2H3,(H,6,7);1H3.
What are the key properties of azane;2-(dimethylamino)acetic acid?
azane;2-(dimethylamino)acetic acid has a molecular weight of 120.15 g/mol, XLogP of -0.21, 2 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for azane;2-(dimethylamino)acetic acid is sourced from PubChem (CID 172828475), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).