About benzoic acid;2-(dimethylamino)acetic acid;zinc
benzoic acid;2-(dimethylamino)acetic acid;zinc (PubChem CID 158543723) has the molecular formula C11H15NO4Zn
and a molecular weight of 290.63 g/mol. Its IUPAC name is benzoic acid;2-(dimethylamino)acetic acid;zinc.
Molecular Properties
| Compound Name | benzoic acid;2-(dimethylamino)acetic acid;zinc |
| PubChem CID | 158543723 |
| Molecular Formula | C11H15NO4Zn |
| Molecular Weight | 290.63 g/mol |
| Exact Mass | 289.03 |
| IUPAC Name | benzoic acid;2-(dimethylamino)acetic acid;zinc |
| SMILES | CN(C)CC(=O)O.O=C(O)c1ccccc1.[Zn] |
| InChI | InChI=1S/C7H6O2.C4H9NO2.Zn/c8-7(9)6-4-2-1-3-5-6;1-5(2)3-4(6)7;/h1-5H,(H,8,9);3H2,1-2H3,(H,6,7); |
| InChIKey | HOVQOYJXPUTWER-UHFFFAOYSA-N |
| XLogP | 1.01 |
| TPSA | 77.84 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 290.63 |
| LogP ≤ 5 | 1.01 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze benzoic acid;2-(dimethylamino)acetic acid;zinc with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of benzoic acid;2-(dimethylamino)acetic acid;zinc?
The IUPAC name of benzoic acid;2-(dimethylamino)acetic acid;zinc (CID 158543723) is benzoic acid;2-(dimethylamino)acetic acid;zinc.
What is the SMILES notation for benzoic acid;2-(dimethylamino)acetic acid;zinc?
The canonical SMILES for benzoic acid;2-(dimethylamino)acetic acid;zinc is CN(C)CC(=O)O.O=C(O)c1ccccc1.[Zn].
What is the InChIKey of benzoic acid;2-(dimethylamino)acetic acid;zinc?
The InChIKey is HOVQOYJXPUTWER-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H6O2.C4H9NO2.Zn/c8-7(9)6-4-2-1-3-5-6;1-5(2)3-4(6)7;/h1-5H,(H,8,9);3H2,1-2H3,(H,6,7);.
What are the key properties of benzoic acid;2-(dimethylamino)acetic acid;zinc?
benzoic acid;2-(dimethylamino)acetic acid;zinc has a molecular weight of 290.63 g/mol, XLogP of 1.01, 3 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for benzoic acid;2-(dimethylamino)acetic acid;zinc is sourced from PubChem (CID 158543723), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).