C4H9Ca3NO10P2 — CID 174914773
tricalcium;2-(dimethylamino)acetic acid;diphosphate (PubChem CID 174914773) has the molecular formula C4H9Ca3NO10P2 and a molecular weight of 413.30 g/mol. Its IUPAC name is tricalcium;2-(dimethylamino)acetic acid;diphosphate.
| Compound Name | tricalcium;2-(dimethylamino)acetic acid;diphosphate |
|---|---|
| PubChem CID | 174914773 |
| Molecular Formula | C4H9Ca3NO10P2 |
| Molecular Weight | 413.30 g/mol |
| Exact Mass | 412.86 |
| IUPAC Name | tricalcium;2-(dimethylamino)acetic acid;diphosphate |
| SMILES | CN(C)CC(=O)O.O=P([O-])([O-])[O-].O=P([O-])([O-])[O-].[Ca+2].[Ca+2].[Ca+2] |
| InChI | InChI=1S/C4H9NO2.3Ca.2H3O4P/c1-5(2)3-4(6)7;;;;2*1-5(2,3)4/h3H2,1-2H3,(H,6,7);;;;2*(H3,1,2,3,4)/q;3*+2;;/p-6 |
| InChIKey | YCZZCUFROGTPKY-UHFFFAOYSA-H |
| XLogP | -7.16 |
| TPSA | 213.04 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 413.30 |
| LogP ≤ 5 | -7.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|