C4H8NNaO2 — CID 23695761
sodium 2-(dimethylamino)acetate (PubChem CID 23695761) has the molecular formula C4H8NNaO2 and a molecular weight of 125.10 g/mol. Its IUPAC name is sodium 2-(dimethylamino)acetate.
| Compound Name | sodium 2-(dimethylamino)acetate |
|---|---|
| PubChem CID | 23695761 |
| Molecular Formula | C4H8NNaO2 |
| Molecular Weight | 125.10 g/mol |
| Exact Mass | 125.05 |
| IUPAC Name | sodium 2-(dimethylamino)acetate |
| SMILES | CN(C)CC(=O)[O-].[Na+] |
| InChI | InChI=1S/C4H9NO2.Na/c1-5(2)3-4(6)7;/h3H2,1-2H3,(H,6,7);/q;+1/p-1 |
| InChIKey | QGPBIYNLYDWLQE-UHFFFAOYSA-M |
| XLogP | -4.70 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 8 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 125.10 |
| LogP ≤ 5 | -4.70 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |