C8H17N2O6PS — CID 143706824
2-[carboxymethyl-[[(dimethylamino)methyl-hydroxysulfanylphosphoryl]methyl]amino]acetic acid (PubChem CID 143706824) has the molecular formula C8H17N2O6PS and a molecular weight of 300.27 g/mol. Its IUPAC name is 2-[carboxymethyl-[[(dimethylamino)methyl-hydroxysulfanylphosphoryl]methyl]amino]acetic acid.
| Compound Name | 2-[carboxymethyl-[[(dimethylamino)methyl-hydroxysulfanylphosphoryl]methyl]amino]acetic acid |
|---|---|
| PubChem CID | 143706824 |
| Molecular Formula | C8H17N2O6PS |
| Molecular Weight | 300.27 g/mol |
| Exact Mass | 300.05 |
| IUPAC Name | 2-[carboxymethyl-[[(dimethylamino)methyl-hydroxysulfanylphosphoryl]methyl]amino]acetic acid |
| SMILES | CN(C)CP(=O)(CN(CC(=O)O)CC(=O)O)SO |
| InChI | InChI=1S/C8H17N2O6PS/c1-9(2)5-17(15,18-16)6-10(3-7(11)12)4-8(13)14/h16H,3-6H2,1-2H3,(H,11,12)(H,13,14) |
| InChIKey | DVNNDDRUXCGGGH-UHFFFAOYSA-N |
| XLogP | 0.42 |
| TPSA | 118.38 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 300.27 |
| LogP ≤ 5 | 0.42 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'sulfur_oxygen_single_bond', 'substructure': 'N/A'} |
|---|