C5H10FeNO7P+2 — CID 85470348
2-[carboxymethyl(phosphonomethyl)amino]acetic acid;iron(2+) (PubChem CID 85470348) has the molecular formula C5H10FeNO7P+2 and a molecular weight of 282.95 g/mol. Its IUPAC name is 2-[carboxymethyl(phosphonomethyl)amino]acetic acid;iron(2+).
| Compound Name | 2-[carboxymethyl(phosphonomethyl)amino]acetic acid;iron(2+) |
|---|---|
| PubChem CID | 85470348 |
| Molecular Formula | C5H10FeNO7P+2 |
| Molecular Weight | 282.95 g/mol |
| Exact Mass | 282.95 |
| IUPAC Name | 2-[carboxymethyl(phosphonomethyl)amino]acetic acid;iron(2+) |
| SMILES | O=C(O)CN(CC(=O)O)CP(=O)(O)O.[Fe+2] |
| InChI | InChI=1S/C5H10NO7P.Fe/c7-4(8)1-6(2-5(9)10)3-14(11,12)13;/h1-3H2,(H,7,8)(H,9,10)(H2,11,12,13);/q;+2 |
| InChIKey | IGSUAZOMIBANBD-UHFFFAOYSA-N |
| XLogP | -1.41 |
| TPSA | 135.37 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 282.95 |
| LogP ≤ 5 | -1.41 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|