C5H8N7O5P — CID 142769230
[bis(2-azido-2-oxoethyl)amino]methylphosphonic acid (PubChem CID 142769230) has the molecular formula C5H8N7O5P and a molecular weight of 277.14 g/mol. Its IUPAC name is [bis(2-azido-2-oxoethyl)amino]methylphosphonic acid.
| Compound Name | [bis(2-azido-2-oxoethyl)amino]methylphosphonic acid |
|---|---|
| PubChem CID | 142769230 |
| Molecular Formula | C5H8N7O5P |
| Molecular Weight | 277.14 g/mol |
| Exact Mass | 277.03 |
| IUPAC Name | [bis(2-azido-2-oxoethyl)amino]methylphosphonic acid |
| SMILES | [N-]=[N+]=NC(=O)CN(CC(=O)N=[N+]=[N-])CP(=O)(O)O |
| InChI | InChI=1S/C5H8N7O5P/c6-10-8-4(13)1-12(3-18(15,16)17)2-5(14)9-11-7/h1-3H2,(H2,15,16,17) |
| InChIKey | HEBJSWQMRCBJSK-UHFFFAOYSA-N |
| XLogP | 0.10 |
| TPSA | 192.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 277.14 |
| LogP ≤ 5 | 0.10 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|