C5H13NO8P2 — CID 58503097
2-[[hydroxy(methoxy)phosphoryl]methyl-(phosphonomethyl)amino]acetic acid (PubChem CID 58503097) has the molecular formula C5H13NO8P2 and a molecular weight of 277.11 g/mol. Its IUPAC name is 2-[[hydroxy(methoxy)phosphoryl]methyl-(phosphonomethyl)amino]acetic acid.
| Compound Name | 2-[[hydroxy(methoxy)phosphoryl]methyl-(phosphonomethyl)amino]acetic acid |
|---|---|
| PubChem CID | 58503097 |
| Molecular Formula | C5H13NO8P2 |
| Molecular Weight | 277.11 g/mol |
| Exact Mass | 277.01 |
| IUPAC Name | 2-[[hydroxy(methoxy)phosphoryl]methyl-(phosphonomethyl)amino]acetic acid |
| SMILES | COP(=O)(O)CN(CC(=O)O)CP(=O)(O)O |
| InChI | InChI=1S/C5H13NO8P2/c1-14-16(12,13)4-6(2-5(7)8)3-15(9,10)11/h2-4H2,1H3,(H,7,8)(H,12,13)(H2,9,10,11) |
| InChIKey | DDMGVDHGLORDHJ-UHFFFAOYSA-N |
| XLogP | -0.70 |
| TPSA | 144.60 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 277.11 |
| LogP ≤ 5 | -0.70 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|