C12H23N3O — CID 60585362
2-[2-cyanopropyl(ethyl)amino]-N,N-diethylacetamide (PubChem CID 60585362) has the molecular formula C12H23N3O and a molecular weight of 225.34 g/mol. Its IUPAC name is 2-[2-cyanopropyl(ethyl)amino]-N,N-diethylacetamide.
| Compound Name | 2-[2-cyanopropyl(ethyl)amino]-N,N-diethylacetamide |
|---|---|
| PubChem CID | 60585362 |
| Molecular Formula | C12H23N3O |
| Molecular Weight | 225.34 g/mol |
| Exact Mass | 225.18 |
| IUPAC Name | 2-[2-cyanopropyl(ethyl)amino]-N,N-diethylacetamide |
| SMILES | CCN(CC(=O)N(CC)CC)CC(C)C#N |
| InChI | InChI=1S/C12H23N3O/c1-5-14(9-11(4)8-13)10-12(16)15(6-2)7-3/h11H,5-7,9-10H2,1-4H3 |
| InChIKey | KKOMNXLMLRVRTL-UHFFFAOYSA-N |
| XLogP | 1.34 |
| TPSA | 47.34 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 225.34 |
| LogP ≤ 5 | 1.34 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |