C4H9ClN2O — CID 19827989
2-(chloroamino)-N-methylpropanamide (PubChem CID 19827989) has the molecular formula C4H9ClN2O and a molecular weight of 136.58 g/mol. Its IUPAC name is 2-(chloroamino)-N-methylpropanamide.
| Compound Name | 2-(chloroamino)-N-methylpropanamide |
|---|---|
| PubChem CID | 19827989 |
| Molecular Formula | C4H9ClN2O |
| Molecular Weight | 136.58 g/mol |
| Exact Mass | 136.04 |
| IUPAC Name | 2-(chloroamino)-N-methylpropanamide |
| SMILES | CNC(=O)C(C)NCl |
| InChI | InChI=1S/C4H9ClN2O/c1-3(7-5)4(8)6-2/h3,7H,1-2H3,(H,6,8) |
| InChIKey | YQUKXPQYDIYAFN-UHFFFAOYSA-N |
| XLogP | -0.14 |
| TPSA | 41.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 8 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 136.58 |
| LogP ≤ 5 | -0.14 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'N-halo', 'substructure': 'N/A'} |
|---|