C8H14N2O2 — CID 23064653
2-methyl-N-[1-(methylamino)-1-oxopropan-2-yl]prop-2-enamide (PubChem CID 23064653) has the molecular formula C8H14N2O2 and a molecular weight of 170.21 g/mol. Its IUPAC name is 2-methyl-N-[1-(methylamino)-1-oxopropan-2-yl]prop-2-enamide.
| Compound Name | 2-methyl-N-[1-(methylamino)-1-oxopropan-2-yl]prop-2-enamide |
|---|---|
| PubChem CID | 23064653 |
| Molecular Formula | C8H14N2O2 |
| Molecular Weight | 170.21 g/mol |
| Exact Mass | 170.11 |
| IUPAC Name | 2-methyl-N-[1-(methylamino)-1-oxopropan-2-yl]prop-2-enamide |
| SMILES | C=C(C)C(=O)NC(C)C(=O)NC |
| InChI | InChI=1S/C8H14N2O2/c1-5(2)7(11)10-6(3)8(12)9-4/h6H,1H2,2-4H3,(H,9,12)(H,10,11) |
| InChIKey | TXIDLXMONDDCPT-UHFFFAOYSA-N |
| XLogP | -0.19 |
| TPSA | 58.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 170.21 |
| LogP ≤ 5 | -0.19 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|