C6H13N3OS — CID 115588003
N-methyl-2-(methylcarbamothioylamino)propanamide (PubChem CID 115588003) has the molecular formula C6H13N3OS and a molecular weight of 175.26 g/mol. Its IUPAC name is N-methyl-2-(methylcarbamothioylamino)propanamide.
| Compound Name | N-methyl-2-(methylcarbamothioylamino)propanamide |
|---|---|
| PubChem CID | 115588003 |
| Molecular Formula | C6H13N3OS |
| Molecular Weight | 175.26 g/mol |
| Exact Mass | 175.08 |
| IUPAC Name | N-methyl-2-(methylcarbamothioylamino)propanamide |
| SMILES | CNC(=O)C(C)NC(=S)NC |
| InChI | InChI=1S/C6H13N3OS/c1-4(5(10)7-2)9-6(11)8-3/h4H,1-3H3,(H,7,10)(H2,8,9,11) |
| InChIKey | RJLODRYUUPPUDC-UHFFFAOYSA-N |
| XLogP | -0.79 |
| TPSA | 53.16 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 175.26 |
| LogP ≤ 5 | -0.79 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|