C6H9BrF2N2O2 — CID 130710592
2-[(2-bromo-2,2-difluoroacetyl)amino]-N-methylpropanamide (PubChem CID 130710592) has the molecular formula C6H9BrF2N2O2 and a molecular weight of 259.05 g/mol. Its IUPAC name is 2-[(2-bromo-2,2-difluoroacetyl)amino]-N-methylpropanamide.
| Compound Name | 2-[(2-bromo-2,2-difluoroacetyl)amino]-N-methylpropanamide |
|---|---|
| PubChem CID | 130710592 |
| Molecular Formula | C6H9BrF2N2O2 |
| Molecular Weight | 259.05 g/mol |
| Exact Mass | 257.98 |
| IUPAC Name | 2-[(2-bromo-2,2-difluoroacetyl)amino]-N-methylpropanamide |
| SMILES | CNC(=O)C(C)NC(=O)C(F)(F)Br |
| InChI | InChI=1S/C6H9BrF2N2O2/c1-3(4(12)10-2)11-5(13)6(7,8)9/h3H,1-2H3,(H,10,12)(H,11,13) |
| InChIKey | GPEQRMXPKNBLKK-UHFFFAOYSA-N |
| XLogP | 0.22 |
| TPSA | 58.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 259.05 |
| LogP ≤ 5 | 0.22 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|