C8H15FN2O2 — CID 130683456
2-fluoro-2-methyl-N-[(2R)-1-(methylamino)-1-oxopropan-2-yl]propanamide (PubChem CID 130683456) has the molecular formula C8H15FN2O2 and a molecular weight of 190.22 g/mol. Its IUPAC name is 2-fluoro-2-methyl-N-[(2R)-1-(methylamino)-1-oxopropan-2-yl]propanamide.
| Compound Name | 2-fluoro-2-methyl-N-[(2R)-1-(methylamino)-1-oxopropan-2-yl]propanamide |
|---|---|
| PubChem CID | 130683456 |
| Molecular Formula | C8H15FN2O2 |
| Molecular Weight | 190.22 g/mol |
| Exact Mass | 190.11 |
| IUPAC Name | 2-fluoro-2-methyl-N-[(2R)-1-(methylamino)-1-oxopropan-2-yl]propanamide |
| SMILES | CNC(=O)[C@@H](C)NC(=O)C(C)(C)F |
| InChI | InChI=1S/C8H15FN2O2/c1-5(6(12)10-4)11-7(13)8(2,3)9/h5H,1-4H3,(H,10,12)(H,11,13)/t5-/m1/s1 |
| InChIKey | GUTPJUBIANZLOM-RXMQYKEDSA-N |
| XLogP | -0.01 |
| TPSA | 58.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 190.22 |
| LogP ≤ 5 | -0.01 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |