C12H20N2O2 — CID 167017883
2-methyl-N-[(2R,3S)-3-(2-methylprop-2-enoylamino)butan-2-yl]prop-2-enamide (PubChem CID 167017883) has the molecular formula C12H20N2O2 and a molecular weight of 224.30 g/mol. Its IUPAC name is 2-methyl-N-[(2R,3S)-3-(2-methylprop-2-enoylamino)butan-2-yl]prop-2-enamide.
| Compound Name | 2-methyl-N-[(2R,3S)-3-(2-methylprop-2-enoylamino)butan-2-yl]prop-2-enamide |
|---|---|
| PubChem CID | 167017883 |
| Molecular Formula | C12H20N2O2 |
| Molecular Weight | 224.30 g/mol |
| Exact Mass | 224.15 |
| IUPAC Name | 2-methyl-N-[(2R,3S)-3-(2-methylprop-2-enoylamino)butan-2-yl]prop-2-enamide |
| SMILES | C=C(C)C(=O)N[C@@H](C)[C@@H](C)NC(=O)C(=C)C |
| InChI | InChI=1S/C12H20N2O2/c1-7(2)11(15)13-9(5)10(6)14-12(16)8(3)4/h9-10H,1,3H2,2,4-6H3,(H,13,15)(H,14,16)/t9-,10+ |
| InChIKey | WTQCDUWNTDURBG-AOOOYVTPSA-N |
| XLogP | 1.15 |
| TPSA | 58.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 224.30 |
| LogP ≤ 5 | 1.15 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|