C7H14NO2+ — CID 87755917
hydron;N-(2-hydroxypropyl)-2-methylprop-2-enamide (PubChem CID 87755917) has the molecular formula C7H14NO2+ and a molecular weight of 144.19 g/mol. Its IUPAC name is hydron;N-(2-hydroxypropyl)-2-methylprop-2-enamide.
| Compound Name | hydron;N-(2-hydroxypropyl)-2-methylprop-2-enamide |
|---|---|
| PubChem CID | 87755917 |
| Molecular Formula | C7H14NO2+ |
| Molecular Weight | 144.19 g/mol |
| Exact Mass | 144.10 |
| IUPAC Name | hydron;N-(2-hydroxypropyl)-2-methylprop-2-enamide |
| SMILES | C=C(C)C(=O)NCC(C)O.[H+] |
| InChI | InChI=1S/C7H13NO2/c1-5(2)7(10)8-4-6(3)9/h6,9H,1,4H2,2-3H3,(H,8,10)/p+1 |
| InChIKey | OKPYIWASQZGASP-UHFFFAOYSA-O |
| XLogP | 0.17 |
| TPSA | 49.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 144.19 |
| LogP ≤ 5 | 0.17 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|