C18H32N2O4 — CID 129238388
2-methyl-N-[2-methyl-3-[2-[2-methyl-3-(2-methylprop-2-enoylamino)propoxy]ethoxy]propyl]prop-2-enamide (PubChem CID 129238388) has the molecular formula C18H32N2O4 and a molecular weight of 340.46 g/mol. Its IUPAC name is 2-methyl-N-[2-methyl-3-[2-[2-methyl-3-(2-methylprop-2-enoylamino)propoxy]ethoxy]propyl]prop-2-enamide.
| Compound Name | 2-methyl-N-[2-methyl-3-[2-[2-methyl-3-(2-methylprop-2-enoylamino)propoxy]ethoxy]propyl]prop-2-enamide |
|---|---|
| PubChem CID | 129238388 |
| Molecular Formula | C18H32N2O4 |
| Molecular Weight | 340.46 g/mol |
| Exact Mass | 340.24 |
| IUPAC Name | 2-methyl-N-[2-methyl-3-[2-[2-methyl-3-(2-methylprop-2-enoylamino)propoxy]ethoxy]propyl]prop-2-enamide |
| SMILES | C=C(C)C(=O)NCC(C)COCCOCC(C)CNC(=O)C(=C)C |
| InChI | InChI=1S/C18H32N2O4/c1-13(2)17(21)19-9-15(5)11-23-7-8-24-12-16(6)10-20-18(22)14(3)4/h15-16H,1,3,7-12H2,2,4-6H3,(H,19,21)(H,20,22) |
| InChIKey | YGNPRIPDGYOQQU-UHFFFAOYSA-N |
| XLogP | 1.68 |
| TPSA | 76.66 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.46 |
| LogP ≤ 5 | 1.68 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|