C8H14KNO4S — CID 138705740
potassium 2-methyl-3-(2-methylprop-2-enoylamino)propane-1-sulfonate (PubChem CID 138705740) has the molecular formula C8H14KNO4S and a molecular weight of 259.37 g/mol. Its IUPAC name is potassium 2-methyl-3-(2-methylprop-2-enoylamino)propane-1-sulfonate.
| Compound Name | potassium 2-methyl-3-(2-methylprop-2-enoylamino)propane-1-sulfonate |
|---|---|
| PubChem CID | 138705740 |
| Molecular Formula | C8H14KNO4S |
| Molecular Weight | 259.37 g/mol |
| Exact Mass | 259.03 |
| IUPAC Name | potassium 2-methyl-3-(2-methylprop-2-enoylamino)propane-1-sulfonate |
| SMILES | C=C(C)C(=O)NCC(C)CS(=O)(=O)[O-].[K+] |
| InChI | InChI=1S/C8H15NO4S.K/c1-6(2)8(10)9-4-7(3)5-14(11,12)13;/h7H,1,4-5H2,2-3H3,(H,9,10)(H,11,12,13);/q;+1/p-1 |
| InChIKey | XXIZKUPSZODDGI-UHFFFAOYSA-M |
| XLogP | -3.14 |
| TPSA | 86.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 259.37 |
| LogP ≤ 5 | -3.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|