C7H14N2O3S — CID 174440551
N-(2-amino-2-methylsulfonylethyl)-2-methylprop-2-enamide (PubChem CID 174440551) has the molecular formula C7H14N2O3S and a molecular weight of 206.27 g/mol. Its IUPAC name is N-(2-amino-2-methylsulfonylethyl)-2-methylprop-2-enamide.
| Compound Name | N-(2-amino-2-methylsulfonylethyl)-2-methylprop-2-enamide |
|---|---|
| PubChem CID | 174440551 |
| Molecular Formula | C7H14N2O3S |
| Molecular Weight | 206.27 g/mol |
| Exact Mass | 206.07 |
| IUPAC Name | N-(2-amino-2-methylsulfonylethyl)-2-methylprop-2-enamide |
| SMILES | C=C(C)C(=O)NCC(N)S(C)(=O)=O |
| InChI | InChI=1S/C7H14N2O3S/c1-5(2)7(10)9-4-6(8)13(3,11)12/h6H,1,4,8H2,2-3H3,(H,9,10) |
| InChIKey | VSHNYJFJHAVDFO-UHFFFAOYSA-N |
| XLogP | -0.99 |
| TPSA | 89.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 206.27 |
| LogP ≤ 5 | -0.99 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|