C7H13N2O3S- — CID 174649622
2-amino-3-(2-methylprop-2-enoylamino)propane-1-sulfinate (PubChem CID 174649622) has the molecular formula C7H13N2O3S- and a molecular weight of 205.26 g/mol. Its IUPAC name is 2-amino-3-(2-methylprop-2-enoylamino)propane-1-sulfinate.
| Compound Name | 2-amino-3-(2-methylprop-2-enoylamino)propane-1-sulfinate |
|---|---|
| PubChem CID | 174649622 |
| Molecular Formula | C7H13N2O3S- |
| Molecular Weight | 205.26 g/mol |
| Exact Mass | 205.07 |
| IUPAC Name | 2-amino-3-(2-methylprop-2-enoylamino)propane-1-sulfinate |
| SMILES | C=C(C)C(=O)NCC(N)CS(=O)[O-] |
| InChI | InChI=1S/C7H14N2O3S/c1-5(2)7(10)9-3-6(8)4-13(11)12/h6H,1,3-4,8H2,2H3,(H,9,10)(H,11,12)/p-1 |
| InChIKey | MCANUBVXSHPCGV-UHFFFAOYSA-M |
| XLogP | -1.11 |
| TPSA | 95.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 205.26 |
| LogP ≤ 5 | -1.11 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'sulfinic_acid', 'substructure': 'N/A'} |
|---|