C11H23N2O+ — CID 87943190
trimethyl-[2-methyl-3-(2-methylprop-2-enoylamino)propyl]azanium (PubChem CID 87943190) has the molecular formula C11H23N2O+ and a molecular weight of 199.32 g/mol. Its IUPAC name is trimethyl-[2-methyl-3-(2-methylprop-2-enoylamino)propyl]azanium.
| Compound Name | trimethyl-[2-methyl-3-(2-methylprop-2-enoylamino)propyl]azanium |
|---|---|
| PubChem CID | 87943190 |
| Molecular Formula | C11H23N2O+ |
| Molecular Weight | 199.32 g/mol |
| Exact Mass | 199.18 |
| IUPAC Name | trimethyl-[2-methyl-3-(2-methylprop-2-enoylamino)propyl]azanium |
| SMILES | C=C(C)C(=O)NCC(C)C[N+](C)(C)C |
| InChI | InChI=1S/C11H22N2O/c1-9(2)11(14)12-7-10(3)8-13(4,5)6/h10H,1,7-8H2,2-6H3/p+1 |
| InChIKey | PLVLEBPNSZCJEG-UHFFFAOYSA-O |
| XLogP | 1.02 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 199.32 |
| LogP ≤ 5 | 1.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|