C14H31N3O2+2 — CID 138394841
[3-[dimethyl-[2-(2-methylprop-2-enoylamino)ethyl]azaniumyl]-2-hydroxypropyl]-trimethylazanium (PubChem CID 138394841) has the molecular formula C14H31N3O2+2 and a molecular weight of 273.42 g/mol. Its IUPAC name is [3-[dimethyl-[2-(2-methylprop-2-enoylamino)ethyl]azaniumyl]-2-hydroxypropyl]-trimethylazanium.
| Compound Name | [3-[dimethyl-[2-(2-methylprop-2-enoylamino)ethyl]azaniumyl]-2-hydroxypropyl]-trimethylazanium |
|---|---|
| PubChem CID | 138394841 |
| Molecular Formula | C14H31N3O2+2 |
| Molecular Weight | 273.42 g/mol |
| Exact Mass | 273.24 |
| IUPAC Name | [3-[dimethyl-[2-(2-methylprop-2-enoylamino)ethyl]azaniumyl]-2-hydroxypropyl]-trimethylazanium |
| SMILES | C=C(C)C(=O)NCC[N+](C)(C)CC(O)C[N+](C)(C)C |
| InChI | InChI=1S/C14H30N3O2/c1-12(2)14(19)15-8-9-17(6,7)11-13(18)10-16(3,4)5/h13,18H,1,8-11H2,2-7H3/q+1/p+1 |
| InChIKey | MUVFTFXTRNALGN-UHFFFAOYSA-O |
| XLogP | -0.18 |
| TPSA | 49.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 273.42 |
| LogP ≤ 5 | -0.18 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|