C23H50N6O3+4 — CID 21026664
[3-[4-[2-[[2-[dimethyl-[3-(2-methylprop-2-enoylamino)propyl]azaniumyl]acetyl]amino]ethyl]piperazine-1,4-diium-1-yl]-2-hydroxypropyl]-trimethylazanium (PubChem CID 21026664) has the molecular formula C23H50N6O3+4 and a molecular weight of 458.69 g/mol. Its IUPAC name is [3-[4-[2-[[2-[dimethyl-[3-(2-methylprop-2-enoylamino)propyl]azaniumyl]acetyl]amino]ethyl]piperazine-1,4-diium-1-yl]-2-hydroxypropyl]-trimethylazanium.
| Compound Name | [3-[4-[2-[[2-[dimethyl-[3-(2-methylprop-2-enoylamino)propyl]azaniumyl]acetyl]amino]ethyl]piperazine-1,4-diium-1-yl]-2-hydroxypropyl]-trimethylazanium |
|---|---|
| PubChem CID | 21026664 |
| Molecular Formula | C23H50N6O3+4 |
| Molecular Weight | 458.69 g/mol |
| Exact Mass | 458.39 |
| IUPAC Name | [3-[4-[2-[[2-[dimethyl-[3-(2-methylprop-2-enoylamino)propyl]azaniumyl]acetyl]amino]ethyl]piperazine-1,4-diium-1-yl]-2-hydroxypropyl]-trimethylazanium |
| SMILES | C=C(C)C(=O)NCCC[N+](C)(C)CC(=O)NCC[NH+]1CC[NH+](CC(O)C[N+](C)(C)C)CC1 |
| InChI | InChI=1S/C23H46N6O3/c1-20(2)23(32)25-9-8-16-29(6,7)19-22(31)24-10-11-26-12-14-27(15-13-26)17-21(30)18-28(3,4)5/h21,30H,1,8-19H2,2-7H3/p+4 |
| InChIKey | MMYIONUZECOYEY-UHFFFAOYSA-R |
| XLogP | -3.89 |
| TPSA | 87.31 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 458.69 |
| LogP ≤ 5 | -3.89 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|