C12H23N2O6S+ — CID 121335182
(2-carboxy-2-sulfoethyl)-dimethyl-[3-(2-methylprop-2-enoylamino)propyl]azanium (PubChem CID 121335182) has the molecular formula C12H23N2O6S+ and a molecular weight of 323.39 g/mol. Its IUPAC name is (2-carboxy-2-sulfoethyl)-dimethyl-[3-(2-methylprop-2-enoylamino)propyl]azanium.
| Compound Name | (2-carboxy-2-sulfoethyl)-dimethyl-[3-(2-methylprop-2-enoylamino)propyl]azanium |
|---|---|
| PubChem CID | 121335182 |
| Molecular Formula | C12H23N2O6S+ |
| Molecular Weight | 323.39 g/mol |
| Exact Mass | 323.13 |
| IUPAC Name | (2-carboxy-2-sulfoethyl)-dimethyl-[3-(2-methylprop-2-enoylamino)propyl]azanium |
| SMILES | C=C(C)C(=O)NCCC[N+](C)(C)CC(C(=O)O)S(=O)(=O)O |
| InChI | InChI=1S/C12H22N2O6S/c1-9(2)11(15)13-6-5-7-14(3,4)8-10(12(16)17)21(18,19)20/h10H,1,5-8H2,2-4H3,(H2-,13,15,16,17,18,19,20)/p+1 |
| InChIKey | PSAOEWQUKDRLIN-UHFFFAOYSA-O |
| XLogP | -0.51 |
| TPSA | 120.77 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 323.39 |
| LogP ≤ 5 | -0.51 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|