C14H29ClN3O2+ — CID 174955703
azane;chloromethane;dimethyl-[3-(2-methylprop-2-enoylamino)propyl]-(2-oxobut-3-enyl)azanium (PubChem CID 174955703) has the molecular formula C14H29ClN3O2+ and a molecular weight of 306.86 g/mol. Its IUPAC name is azane;chloromethane;dimethyl-[3-(2-methylprop-2-enoylamino)propyl]-(2-oxobut-3-enyl)azanium.
| Compound Name | azane;chloromethane;dimethyl-[3-(2-methylprop-2-enoylamino)propyl]-(2-oxobut-3-enyl)azanium |
|---|---|
| PubChem CID | 174955703 |
| Molecular Formula | C14H29ClN3O2+ |
| Molecular Weight | 306.86 g/mol |
| Exact Mass | 306.19 |
| IUPAC Name | azane;chloromethane;dimethyl-[3-(2-methylprop-2-enoylamino)propyl]-(2-oxobut-3-enyl)azanium |
| SMILES | C=CC(=O)C[N+](C)(C)CCCNC(=O)C(=C)C.CCl.N |
| InChI | InChI=1S/C13H22N2O2.CH3Cl.H3N/c1-6-12(16)10-15(4,5)9-7-8-14-13(17)11(2)3;1-2;/h6H,1-2,7-10H2,3-5H3;1H3;1H3/p+1 |
| InChIKey | KNJFRPSAUARUOA-UHFFFAOYSA-O |
| XLogP | 1.92 |
| TPSA | 81.17 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 306.86 |
| LogP ≤ 5 | 1.92 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|