C16H32N3O5+ — CID 22178957
2-carboxyethyl-dimethyl-[2-(2-methylprop-2-enoylamino)ethyl]azanium;2-(trimethylazaniumyl)acetate (PubChem CID 22178957) has the molecular formula C16H32N3O5+ and a molecular weight of 346.45 g/mol. Its IUPAC name is 2-carboxyethyl-dimethyl-[2-(2-methylprop-2-enoylamino)ethyl]azanium;2-(trimethylazaniumyl)acetate.
| Compound Name | 2-carboxyethyl-dimethyl-[2-(2-methylprop-2-enoylamino)ethyl]azanium;2-(trimethylazaniumyl)acetate |
|---|---|
| PubChem CID | 22178957 |
| Molecular Formula | C16H32N3O5+ |
| Molecular Weight | 346.45 g/mol |
| Exact Mass | 346.23 |
| IUPAC Name | 2-carboxyethyl-dimethyl-[2-(2-methylprop-2-enoylamino)ethyl]azanium;2-(trimethylazaniumyl)acetate |
| SMILES | C=C(C)C(=O)NCC[N+](C)(C)CCC(=O)O.C[N+](C)(C)CC(=O)[O-] |
| InChI | InChI=1S/C11H20N2O3.C5H11NO2/c1-9(2)11(16)12-6-8-13(3,4)7-5-10(14)15;1-6(2,3)4-5(7)8/h1,5-8H2,2-4H3,(H-,12,14,15,16);4H2,1-3H3/p+1 |
| InChIKey | FGLOCEDFKWZTOQ-UHFFFAOYSA-O |
| XLogP | -1.33 |
| TPSA | 106.53 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.45 |
| LogP ≤ 5 | -1.33 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|