C14H26N2O4 — CID 159380399
N-(2-hydroxypropyl)-2-methylprop-2-enamide (PubChem CID 159380399) has the molecular formula C14H26N2O4 and a molecular weight of 286.37 g/mol. Its IUPAC name is N-(2-hydroxypropyl)-2-methylprop-2-enamide.
| Compound Name | N-(2-hydroxypropyl)-2-methylprop-2-enamide |
|---|---|
| PubChem CID | 159380399 |
| Molecular Formula | C14H26N2O4 |
| Molecular Weight | 286.37 g/mol |
| Exact Mass | 286.19 |
| IUPAC Name | N-(2-hydroxypropyl)-2-methylprop-2-enamide |
| SMILES | C=C(C)C(=O)NCC(C)O.C=C(C)C(=O)NCC(C)O |
| InChI | InChI=1S/2C7H13NO2/c2*1-5(2)7(10)8-4-6(3)9/h2*6,9H,1,4H2,2-3H3,(H,8,10) |
| InChIKey | LKVGZQMHSNFNIM-UHFFFAOYSA-N |
| XLogP | 0.12 |
| TPSA | 98.66 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 286.37 |
| LogP ≤ 5 | 0.12 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|