C13H29N5O3S — CID 139973185
N-[2-[2-[2-[2-(methanesulfonamido)ethylamino]ethylamino]ethylamino]ethyl]-2-methylprop-2-enamide (PubChem CID 139973185) has the molecular formula C13H29N5O3S and a molecular weight of 335.47 g/mol. Its IUPAC name is N-[2-[2-[2-[2-(methanesulfonamido)ethylamino]ethylamino]ethylamino]ethyl]-2-methylprop-2-enamide.
| Compound Name | N-[2-[2-[2-[2-(methanesulfonamido)ethylamino]ethylamino]ethylamino]ethyl]-2-methylprop-2-enamide |
|---|---|
| PubChem CID | 139973185 |
| Molecular Formula | C13H29N5O3S |
| Molecular Weight | 335.47 g/mol |
| Exact Mass | 335.20 |
| IUPAC Name | N-[2-[2-[2-[2-(methanesulfonamido)ethylamino]ethylamino]ethylamino]ethyl]-2-methylprop-2-enamide |
| SMILES | C=C(C)C(=O)NCCNCCNCCNCCNS(C)(=O)=O |
| InChI | InChI=1S/C13H29N5O3S/c1-12(2)13(19)17-10-8-15-6-4-14-5-7-16-9-11-18-22(3,20)21/h14-16,18H,1,4-11H2,2-3H3,(H,17,19) |
| InChIKey | JVTSBKYZQFLMHQ-UHFFFAOYSA-N |
| XLogP | -2.00 |
| TPSA | 111.36 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 335.47 |
| LogP ≤ 5 | -2.00 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|