C7H15ClN2O3S — CID 62728659
3-chloro-N-[2-(methanesulfonamido)ethyl]-2-methylpropanamide (PubChem CID 62728659) has the molecular formula C7H15ClN2O3S and a molecular weight of 242.73 g/mol. Its IUPAC name is 3-chloro-N-[2-(methanesulfonamido)ethyl]-2-methylpropanamide.
| Compound Name | 3-chloro-N-[2-(methanesulfonamido)ethyl]-2-methylpropanamide |
|---|---|
| PubChem CID | 62728659 |
| Molecular Formula | C7H15ClN2O3S |
| Molecular Weight | 242.73 g/mol |
| Exact Mass | 242.05 |
| IUPAC Name | 3-chloro-N-[2-(methanesulfonamido)ethyl]-2-methylpropanamide |
| SMILES | CC(CCl)C(=O)NCCNS(C)(=O)=O |
| InChI | InChI=1S/C7H15ClN2O3S/c1-6(5-8)7(11)9-3-4-10-14(2,12)13/h6,10H,3-5H2,1-2H3,(H,9,11) |
| InChIKey | PJLSOTNAAIHQDK-UHFFFAOYSA-N |
| XLogP | -0.47 |
| TPSA | 75.27 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 242.73 |
| LogP ≤ 5 | -0.47 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|