C7H14ClN3O4S — CID 43546318
3-chloro-N-[2-(methanesulfonamido)ethylcarbamoyl]propanamide (PubChem CID 43546318) has the molecular formula C7H14ClN3O4S and a molecular weight of 271.73 g/mol. Its IUPAC name is 3-chloro-N-[2-(methanesulfonamido)ethylcarbamoyl]propanamide.
| Compound Name | 3-chloro-N-[2-(methanesulfonamido)ethylcarbamoyl]propanamide |
|---|---|
| PubChem CID | 43546318 |
| Molecular Formula | C7H14ClN3O4S |
| Molecular Weight | 271.73 g/mol |
| Exact Mass | 271.04 |
| IUPAC Name | 3-chloro-N-[2-(methanesulfonamido)ethylcarbamoyl]propanamide |
| SMILES | CS(=O)(=O)NCCNC(=O)NC(=O)CCCl |
| InChI | InChI=1S/C7H14ClN3O4S/c1-16(14,15)10-5-4-9-7(13)11-6(12)2-3-8/h10H,2-5H2,1H3,(H2,9,11,12,13) |
| InChIKey | HISVRNACAZUTOO-UHFFFAOYSA-N |
| XLogP | -1.01 |
| TPSA | 104.37 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 271.73 |
| LogP ≤ 5 | -1.01 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|