C11H21N3O6S — CID 106340011
6-[3-(methanesulfonamido)propylcarbamoylamino]-6-oxohexanoic acid (PubChem CID 106340011) has the molecular formula C11H21N3O6S and a molecular weight of 323.37 g/mol. Its IUPAC name is 6-[3-(methanesulfonamido)propylcarbamoylamino]-6-oxohexanoic acid.
| Compound Name | 6-[3-(methanesulfonamido)propylcarbamoylamino]-6-oxohexanoic acid |
|---|---|
| PubChem CID | 106340011 |
| Molecular Formula | C11H21N3O6S |
| Molecular Weight | 323.37 g/mol |
| Exact Mass | 323.12 |
| IUPAC Name | 6-[3-(methanesulfonamido)propylcarbamoylamino]-6-oxohexanoic acid |
| SMILES | CS(=O)(=O)NCCCNC(=O)NC(=O)CCCCC(=O)O |
| InChI | InChI=1S/C11H21N3O6S/c1-21(19,20)13-8-4-7-12-11(18)14-9(15)5-2-3-6-10(16)17/h13H,2-8H2,1H3,(H,16,17)(H2,12,14,15,18) |
| InChIKey | AMLFAPOGDUSORR-UHFFFAOYSA-N |
| XLogP | -0.60 |
| TPSA | 141.67 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 323.37 |
| LogP ≤ 5 | -0.60 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|