C9H17N3O6S — CID 106340043
4-[2-(ethylsulfamoyl)ethylcarbamoylamino]-4-oxobutanoic acid (PubChem CID 106340043) has the molecular formula C9H17N3O6S and a molecular weight of 295.32 g/mol. Its IUPAC name is 4-[2-(ethylsulfamoyl)ethylcarbamoylamino]-4-oxobutanoic acid.
| Compound Name | 4-[2-(ethylsulfamoyl)ethylcarbamoylamino]-4-oxobutanoic acid |
|---|---|
| PubChem CID | 106340043 |
| Molecular Formula | C9H17N3O6S |
| Molecular Weight | 295.32 g/mol |
| Exact Mass | 295.08 |
| IUPAC Name | 4-[2-(ethylsulfamoyl)ethylcarbamoylamino]-4-oxobutanoic acid |
| SMILES | CCNS(=O)(=O)CCNC(=O)NC(=O)CCC(=O)O |
| InChI | InChI=1S/C9H17N3O6S/c1-2-11-19(17,18)6-5-10-9(16)12-7(13)3-4-8(14)15/h11H,2-6H2,1H3,(H,14,15)(H2,10,12,13,16) |
| InChIKey | NBGXBVWRJHCHEZ-UHFFFAOYSA-N |
| XLogP | -1.38 |
| TPSA | 141.67 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 295.32 |
| LogP ≤ 5 | -1.38 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |