C10H20N2O5S — CID 106334761
4-[2-(ethylsulfamoyl)ethylamino]-2,2-dimethyl-4-oxobutanoic acid (PubChem CID 106334761) has the molecular formula C10H20N2O5S and a molecular weight of 280.35 g/mol. Its IUPAC name is 4-[2-(ethylsulfamoyl)ethylamino]-2,2-dimethyl-4-oxobutanoic acid.
| Compound Name | 4-[2-(ethylsulfamoyl)ethylamino]-2,2-dimethyl-4-oxobutanoic acid |
|---|---|
| PubChem CID | 106334761 |
| Molecular Formula | C10H20N2O5S |
| Molecular Weight | 280.35 g/mol |
| Exact Mass | 280.11 |
| IUPAC Name | 4-[2-(ethylsulfamoyl)ethylamino]-2,2-dimethyl-4-oxobutanoic acid |
| SMILES | CCNS(=O)(=O)CCNC(=O)CC(C)(C)C(=O)O |
| InChI | InChI=1S/C10H20N2O5S/c1-4-12-18(16,17)6-5-11-8(13)7-10(2,3)9(14)15/h12H,4-7H2,1-3H3,(H,11,13)(H,14,15) |
| InChIKey | BIEQLCLSDNLPOW-UHFFFAOYSA-N |
| XLogP | -0.46 |
| TPSA | 112.57 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 280.35 |
| LogP ≤ 5 | -0.46 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |