C11H23N3O5S — CID 106340782
2-[tert-butyl-[2-(ethylsulfamoyl)ethylcarbamoyl]amino]acetic acid (PubChem CID 106340782) has the molecular formula C11H23N3O5S and a molecular weight of 309.39 g/mol. Its IUPAC name is 2-[tert-butyl-[2-(ethylsulfamoyl)ethylcarbamoyl]amino]acetic acid.
| Compound Name | 2-[tert-butyl-[2-(ethylsulfamoyl)ethylcarbamoyl]amino]acetic acid |
|---|---|
| PubChem CID | 106340782 |
| Molecular Formula | C11H23N3O5S |
| Molecular Weight | 309.39 g/mol |
| Exact Mass | 309.14 |
| IUPAC Name | 2-[tert-butyl-[2-(ethylsulfamoyl)ethylcarbamoyl]amino]acetic acid |
| SMILES | CCNS(=O)(=O)CCNC(=O)N(CC(=O)O)C(C)(C)C |
| InChI | InChI=1S/C11H23N3O5S/c1-5-13-20(18,19)7-6-12-10(17)14(8-9(15)16)11(2,3)4/h13H,5-8H2,1-4H3,(H,12,17)(H,15,16) |
| InChIKey | AQNMQQCAMAYNRS-UHFFFAOYSA-N |
| XLogP | -0.18 |
| TPSA | 115.81 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 309.39 |
| LogP ≤ 5 | -0.18 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |