C15H31N3O3 — CID 79264253
2-[tert-butyl-[4-[methyl(propan-2-yl)amino]butylcarbamoyl]amino]acetic acid (PubChem CID 79264253) has the molecular formula C15H31N3O3 and a molecular weight of 301.43 g/mol. Its IUPAC name is 2-[tert-butyl-[4-[methyl(propan-2-yl)amino]butylcarbamoyl]amino]acetic acid.
| Compound Name | 2-[tert-butyl-[4-[methyl(propan-2-yl)amino]butylcarbamoyl]amino]acetic acid |
|---|---|
| PubChem CID | 79264253 |
| Molecular Formula | C15H31N3O3 |
| Molecular Weight | 301.43 g/mol |
| Exact Mass | 301.24 |
| IUPAC Name | 2-[tert-butyl-[4-[methyl(propan-2-yl)amino]butylcarbamoyl]amino]acetic acid |
| SMILES | CC(C)N(C)CCCCNC(=O)N(CC(=O)O)C(C)(C)C |
| InChI | InChI=1S/C15H31N3O3/c1-12(2)17(6)10-8-7-9-16-14(21)18(11-13(19)20)15(3,4)5/h12H,7-11H2,1-6H3,(H,16,21)(H,19,20) |
| InChIKey | XPBXGACOVMVQCX-UHFFFAOYSA-N |
| XLogP | 2.00 |
| TPSA | 72.88 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 301.43 |
| LogP ≤ 5 | 2.00 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|