C14H29N3O4 — CID 79272017
2-[2-methoxyethyl-[4-[methyl(propan-2-yl)amino]butylcarbamoyl]amino]acetic acid (PubChem CID 79272017) has the molecular formula C14H29N3O4 and a molecular weight of 303.40 g/mol. Its IUPAC name is 2-[2-methoxyethyl-[4-[methyl(propan-2-yl)amino]butylcarbamoyl]amino]acetic acid.
| Compound Name | 2-[2-methoxyethyl-[4-[methyl(propan-2-yl)amino]butylcarbamoyl]amino]acetic acid |
|---|---|
| PubChem CID | 79272017 |
| Molecular Formula | C14H29N3O4 |
| Molecular Weight | 303.40 g/mol |
| Exact Mass | 303.22 |
| IUPAC Name | 2-[2-methoxyethyl-[4-[methyl(propan-2-yl)amino]butylcarbamoyl]amino]acetic acid |
| SMILES | COCCN(CC(=O)O)C(=O)NCCCCN(C)C(C)C |
| InChI | InChI=1S/C14H29N3O4/c1-12(2)16(3)8-6-5-7-15-14(20)17(9-10-21-4)11-13(18)19/h12H,5-11H2,1-4H3,(H,15,20)(H,18,19) |
| InChIKey | RWMHIGIIAKFQQE-UHFFFAOYSA-N |
| XLogP | 0.85 |
| TPSA | 82.11 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 303.40 |
| LogP ≤ 5 | 0.85 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|