C10H21N3O6S — CID 103995553
2-[3-(methanesulfonamido)propylcarbamoyl-(2-methoxyethyl)amino]acetic acid (PubChem CID 103995553) has the molecular formula C10H21N3O6S and a molecular weight of 311.36 g/mol. Its IUPAC name is 2-[3-(methanesulfonamido)propylcarbamoyl-(2-methoxyethyl)amino]acetic acid.
| Compound Name | 2-[3-(methanesulfonamido)propylcarbamoyl-(2-methoxyethyl)amino]acetic acid |
|---|---|
| PubChem CID | 103995553 |
| Molecular Formula | C10H21N3O6S |
| Molecular Weight | 311.36 g/mol |
| Exact Mass | 311.12 |
| IUPAC Name | 2-[3-(methanesulfonamido)propylcarbamoyl-(2-methoxyethyl)amino]acetic acid |
| SMILES | COCCN(CC(=O)O)C(=O)NCCCNS(C)(=O)=O |
| InChI | InChI=1S/C10H21N3O6S/c1-19-7-6-13(8-9(14)15)10(16)11-4-3-5-12-20(2,17)18/h12H,3-8H2,1-2H3,(H,11,16)(H,14,15) |
| InChIKey | JPMVOXGRGUJJSL-UHFFFAOYSA-N |
| XLogP | -1.33 |
| TPSA | 125.04 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 311.36 |
| LogP ≤ 5 | -1.33 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|