C11H19N5O4 — CID 79269696
2-[2-methoxyethyl-[3-(1H-1,2,4-triazol-5-yl)propylcarbamoyl]amino]acetic acid (PubChem CID 79269696) has the molecular formula C11H19N5O4 and a molecular weight of 285.30 g/mol. Its IUPAC name is 2-[2-methoxyethyl-[3-(1H-1,2,4-triazol-5-yl)propylcarbamoyl]amino]acetic acid.
| Compound Name | 2-[2-methoxyethyl-[3-(1H-1,2,4-triazol-5-yl)propylcarbamoyl]amino]acetic acid |
|---|---|
| PubChem CID | 79269696 |
| Molecular Formula | C11H19N5O4 |
| Molecular Weight | 285.30 g/mol |
| Exact Mass | 285.14 |
| IUPAC Name | 2-[2-methoxyethyl-[3-(1H-1,2,4-triazol-5-yl)propylcarbamoyl]amino]acetic acid |
| SMILES | COCCN(CC(=O)O)C(=O)NCCCc1ncn[nH]1 |
| InChI | InChI=1S/C11H19N5O4/c1-20-6-5-16(7-10(17)18)11(19)12-4-2-3-9-13-8-14-15-9/h8H,2-7H2,1H3,(H,12,19)(H,17,18)(H,13,14,15) |
| InChIKey | WSBNCNYTORYVOC-UHFFFAOYSA-N |
| XLogP | -0.52 |
| TPSA | 120.44 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 285.30 |
| LogP ≤ 5 | -0.52 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|