C11H22N4O5 — CID 83113976
2-[2-(dimethylcarbamoylamino)ethylcarbamoyl-(2-methoxyethyl)amino]acetic acid (PubChem CID 83113976) has the molecular formula C11H22N4O5 and a molecular weight of 290.32 g/mol. Its IUPAC name is 2-[2-(dimethylcarbamoylamino)ethylcarbamoyl-(2-methoxyethyl)amino]acetic acid.
| Compound Name | 2-[2-(dimethylcarbamoylamino)ethylcarbamoyl-(2-methoxyethyl)amino]acetic acid |
|---|---|
| PubChem CID | 83113976 |
| Molecular Formula | C11H22N4O5 |
| Molecular Weight | 290.32 g/mol |
| Exact Mass | 290.16 |
| IUPAC Name | 2-[2-(dimethylcarbamoylamino)ethylcarbamoyl-(2-methoxyethyl)amino]acetic acid |
| SMILES | COCCN(CC(=O)O)C(=O)NCCNC(=O)N(C)C |
| InChI | InChI=1S/C11H22N4O5/c1-14(2)10(18)12-4-5-13-11(19)15(6-7-20-3)8-9(16)17/h4-8H2,1-3H3,(H,12,18)(H,13,19)(H,16,17) |
| InChIKey | BIIMARFHYULCEP-UHFFFAOYSA-N |
| XLogP | -1.00 |
| TPSA | 111.21 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 290.32 |
| LogP ≤ 5 | -1.00 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|