C12H24N2O6 — CID 79272631
2-[bis(2-methoxyethyl)carbamoyl-(2-methoxyethyl)amino]acetic acid (PubChem CID 79272631) has the molecular formula C12H24N2O6 and a molecular weight of 292.33 g/mol. Its IUPAC name is 2-[bis(2-methoxyethyl)carbamoyl-(2-methoxyethyl)amino]acetic acid.
| Compound Name | 2-[bis(2-methoxyethyl)carbamoyl-(2-methoxyethyl)amino]acetic acid |
|---|---|
| PubChem CID | 79272631 |
| Molecular Formula | C12H24N2O6 |
| Molecular Weight | 292.33 g/mol |
| Exact Mass | 292.16 |
| IUPAC Name | 2-[bis(2-methoxyethyl)carbamoyl-(2-methoxyethyl)amino]acetic acid |
| SMILES | COCCN(CCOC)C(=O)N(CCOC)CC(=O)O |
| InChI | InChI=1S/C12H24N2O6/c1-18-7-4-13(5-8-19-2)12(17)14(6-9-20-3)10-11(15)16/h4-10H2,1-3H3,(H,15,16) |
| InChIKey | OYCTUAPXDKNKLZ-UHFFFAOYSA-N |
| XLogP | -0.27 |
| TPSA | 88.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 292.33 |
| LogP ≤ 5 | -0.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |