C12H23N3O5S — CID 106340334
2-[cyclopentyl-[3-(methanesulfonamido)propylcarbamoyl]amino]acetic acid (PubChem CID 106340334) has the molecular formula C12H23N3O5S and a molecular weight of 321.40 g/mol. Its IUPAC name is 2-[cyclopentyl-[3-(methanesulfonamido)propylcarbamoyl]amino]acetic acid.
| Compound Name | 2-[cyclopentyl-[3-(methanesulfonamido)propylcarbamoyl]amino]acetic acid |
|---|---|
| PubChem CID | 106340334 |
| Molecular Formula | C12H23N3O5S |
| Molecular Weight | 321.40 g/mol |
| Exact Mass | 321.14 |
| IUPAC Name | 2-[cyclopentyl-[3-(methanesulfonamido)propylcarbamoyl]amino]acetic acid |
| SMILES | CS(=O)(=O)NCCCNC(=O)N(CC(=O)O)C1CCCC1 |
| InChI | InChI=1S/C12H23N3O5S/c1-21(19,20)14-8-4-7-13-12(18)15(9-11(16)17)10-5-2-3-6-10/h10,14H,2-9H2,1H3,(H,13,18)(H,16,17) |
| InChIKey | AOWXDWNRLSXICG-UHFFFAOYSA-N |
| XLogP | -0.04 |
| TPSA | 115.81 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 321.40 |
| LogP ≤ 5 | -0.04 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|