C12H22N2O4 — CID 82944448
2-[cyclopropyl(3-propoxypropylcarbamoyl)amino]acetic acid (PubChem CID 82944448) has the molecular formula C12H22N2O4 and a molecular weight of 258.32 g/mol. Its IUPAC name is 2-[cyclopropyl(3-propoxypropylcarbamoyl)amino]acetic acid.
| Compound Name | 2-[cyclopropyl(3-propoxypropylcarbamoyl)amino]acetic acid |
|---|---|
| PubChem CID | 82944448 |
| Molecular Formula | C12H22N2O4 |
| Molecular Weight | 258.32 g/mol |
| Exact Mass | 258.16 |
| IUPAC Name | 2-[cyclopropyl(3-propoxypropylcarbamoyl)amino]acetic acid |
| SMILES | CCCOCCCNC(=O)N(CC(=O)O)C1CC1 |
| InChI | InChI=1S/C12H22N2O4/c1-2-7-18-8-3-6-13-12(17)14(9-11(15)16)10-4-5-10/h10H,2-9H2,1H3,(H,13,17)(H,15,16) |
| InChIKey | QSLSIELNKKJUPD-UHFFFAOYSA-N |
| XLogP | 1.06 |
| TPSA | 78.87 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 258.32 |
| LogP ≤ 5 | 1.06 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|