C11H25N3O3S — CID 103840332
2-(aminomethyl)-2-ethyl-N-[2-(ethylsulfamoyl)ethyl]butanamide (PubChem CID 103840332) has the molecular formula C11H25N3O3S and a molecular weight of 279.41 g/mol. Its IUPAC name is 2-(aminomethyl)-2-ethyl-N-[2-(ethylsulfamoyl)ethyl]butanamide.
| Compound Name | 2-(aminomethyl)-2-ethyl-N-[2-(ethylsulfamoyl)ethyl]butanamide |
|---|---|
| PubChem CID | 103840332 |
| Molecular Formula | C11H25N3O3S |
| Molecular Weight | 279.41 g/mol |
| Exact Mass | 279.16 |
| IUPAC Name | 2-(aminomethyl)-2-ethyl-N-[2-(ethylsulfamoyl)ethyl]butanamide |
| SMILES | CCNS(=O)(=O)CCNC(=O)C(CC)(CC)CN |
| InChI | InChI=1S/C11H25N3O3S/c1-4-11(5-2,9-12)10(15)13-7-8-18(16,17)14-6-3/h14H,4-9,12H2,1-3H3,(H,13,15) |
| InChIKey | AJGVCLHEPPKLSL-UHFFFAOYSA-N |
| XLogP | -0.19 |
| TPSA | 101.29 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 279.41 |
| LogP ≤ 5 | -0.19 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |