C10H19N3O3S — CID 114175317
2-cyano-N-[2-(ethylsulfamoyl)ethyl]-2-methylbutanamide (PubChem CID 114175317) has the molecular formula C10H19N3O3S and a molecular weight of 261.35 g/mol. Its IUPAC name is 2-cyano-N-[2-(ethylsulfamoyl)ethyl]-2-methylbutanamide.
| Compound Name | 2-cyano-N-[2-(ethylsulfamoyl)ethyl]-2-methylbutanamide |
|---|---|
| PubChem CID | 114175317 |
| Molecular Formula | C10H19N3O3S |
| Molecular Weight | 261.35 g/mol |
| Exact Mass | 261.11 |
| IUPAC Name | 2-cyano-N-[2-(ethylsulfamoyl)ethyl]-2-methylbutanamide |
| SMILES | CCNS(=O)(=O)CCNC(=O)C(C)(C#N)CC |
| InChI | InChI=1S/C10H19N3O3S/c1-4-10(3,8-11)9(14)12-6-7-17(15,16)13-5-2/h13H,4-7H2,1-3H3,(H,12,14) |
| InChIKey | XIELLPMTAOPWKB-UHFFFAOYSA-N |
| XLogP | -0.02 |
| TPSA | 99.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 261.35 |
| LogP ≤ 5 | -0.02 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |