C7H13N3O6S — CID 43552577
4-oxo-4-(2-sulfamoylethylcarbamoylamino)butanoic acid (PubChem CID 43552577) has the molecular formula C7H13N3O6S and a molecular weight of 267.26 g/mol. Its IUPAC name is 4-oxo-4-(2-sulfamoylethylcarbamoylamino)butanoic acid.
| Compound Name | 4-oxo-4-(2-sulfamoylethylcarbamoylamino)butanoic acid |
|---|---|
| PubChem CID | 43552577 |
| Molecular Formula | C7H13N3O6S |
| Molecular Weight | 267.26 g/mol |
| Exact Mass | 267.05 |
| IUPAC Name | 4-oxo-4-(2-sulfamoylethylcarbamoylamino)butanoic acid |
| SMILES | NS(=O)(=O)CCNC(=O)NC(=O)CCC(=O)O |
| InChI | InChI=1S/C7H13N3O6S/c8-17(15,16)4-3-9-7(14)10-5(11)1-2-6(12)13/h1-4H2,(H,12,13)(H2,8,15,16)(H2,9,10,11,14) |
| InChIKey | QAPUIQMNRPRGMA-UHFFFAOYSA-N |
| XLogP | -2.03 |
| TPSA | 155.66 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 267.26 |
| LogP ≤ 5 | -2.03 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |