C5H10N2O5S — CID 62230210
3-oxo-3-(2-sulfamoylethylamino)propanoic acid (PubChem CID 62230210) has the molecular formula C5H10N2O5S and a molecular weight of 210.21 g/mol. Its IUPAC name is 3-oxo-3-(2-sulfamoylethylamino)propanoic acid.
| Compound Name | 3-oxo-3-(2-sulfamoylethylamino)propanoic acid |
|---|---|
| PubChem CID | 62230210 |
| Molecular Formula | C5H10N2O5S |
| Molecular Weight | 210.21 g/mol |
| Exact Mass | 210.03 |
| IUPAC Name | 3-oxo-3-(2-sulfamoylethylamino)propanoic acid |
| SMILES | NS(=O)(=O)CCNC(=O)CC(=O)O |
| InChI | InChI=1S/C5H10N2O5S/c6-13(11,12)2-1-7-4(8)3-5(9)10/h1-3H2,(H,7,8)(H,9,10)(H2,6,11,12) |
| InChIKey | SSFRAKQQHRELEQ-UHFFFAOYSA-N |
| XLogP | -2.13 |
| TPSA | 126.56 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 210.21 |
| LogP ≤ 5 | -2.13 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|